|
|
| | 1,4-BENZENEDIMETHANETHIOL Basic information |
| | 1,4-BENZENEDIMETHANETHIOL Chemical Properties |
| Melting point | 45-46 °C (lit.) | | Boiling point | 156 °C/12 mmHg (lit.) | | density | 1.1604 (rough estimate) | | refractive index | 1.6210 (estimate) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | pka | 9.41±0.10(Predicted) | | form | powder to lump | | color | White to Almost white | | InChI | InChI=1S/C8H10S2/c9-5-7-1-2-8(6-10)4-3-7/h1-4,9-10H,5-6H2 | | InChIKey | IYPNRTQAOXLCQW-UHFFFAOYSA-N | | SMILES | C1(CS)=CC=C(CS)C=C1 | | CAS DataBase Reference | 105-09-9(CAS DataBase Reference) | | EPA Substance Registry System | 1,4-Benzenedimethanethiol (105-09-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | UN 3335 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,4-BENZENEDIMETHANETHIOL Usage And Synthesis |
| Uses | 1,4-Benzenedimethanethiol was used as cross linker in the fabrication of nanoporous gold on glassy carbon electrode by alternatively assembling gold nanoparticles and silver nanoparticles. It was used as capping reagent during the preparation of Au and Ag clusters of 3 nm mean diameter. It was used as ligand in the synthesis of 1,4-benzenedimethanethiol-capped gold nanoparticles. | | General Description | 1,4-Benzenedimethanethiol forms self-assembled monolayers on gold in n-hexane solution. |
| | 1,4-BENZENEDIMETHANETHIOL Preparation Products And Raw materials |
|