|
|
| | 5,5-DIBROMOBARBITURIC ACID Basic information |
| Product Name: | 5,5-DIBROMOBARBITURIC ACID | | Synonyms: | 5,5-DIBROMOBARBITURIC ACID;Barbituric acid, 5,5-dibromo-;5,5-Dibromohexahydropyrimidine-2,4,6-trione;5,5-Dibromopyrimidine-2,4,6(1H,3H,5H)-trione;Dibromin;5,5-Dibromo-2,4,6(1H,3H,5H)-pyrimidinetrione;5,5-dibromo-1,3-diazinane-2,4,6-trione;5,5-Di BroMo Barbutyric Acid | | CAS: | 511-67-1 | | MF: | C4H2Br2N2O3 | | MW: | 285.88 | | EINECS: | 208-131-7 | | Product Categories: | Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Pyrimidines;PyrimidinesHeterocyclic Building Blocks | | Mol File: | 511-67-1.mol |  |
| | 5,5-DIBROMOBARBITURIC ACID Chemical Properties |
| Melting point | 240-242 °C(lit.) | | density | 2.5685 (rough estimate) | | refractive index | 1.6220 (estimate) | | storage temp. | Storage temp. 2-8°C | | solubility | DMSO (Sparingly) | | pka | pKa 5.68±0.02(H2O t=25.0±0.02 I=0.00)(Approximate) | | form | Solid | | color | Pale Beige to Light Orange | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C4H2Br2N2O3/c5-4(6)1(9)7-3(11)8-2(4)10/h(H2,7,8,9,10,11) | | InChIKey | AMATXUCYHHHHHB-UHFFFAOYSA-N | | SMILES | C1(=O)NC(=O)C(Br)(Br)C(=O)N1 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2933599590 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 5,5-DIBROMOBARBITURIC ACID Usage And Synthesis |
| Uses | 5,5-Dibromobarbituric acid was used in the synthesis of condensed pteridine system by undergoing condensation with 4,5-diamino-pyrimidines in the presence of pyridine. |
| | 5,5-DIBROMOBARBITURIC ACID Preparation Products And Raw materials |
|