|
|
| | 2-(HYDROXYMETHYL)ANTHRAQUINONE Basic information |
| Product Name: | 2-(HYDROXYMETHYL)ANTHRAQUINONE | | Synonyms: | 2-HYDROXYMETHYL-9,10-ANTHRACENEDIONE;2-(HYDROXYMETHYL)ANTHRAQUINONE;2-(hydroxymethyl)-anthraquinon;ANTHRAQUINONE-2-METHANOL;2-(Hydroxymethyl)anthraquinone,97%;2-(HydroxyMethyl)anthraquinone, 97% 5GR;9,10-Anthracenedione, 2-(hydroxyMethyl)-;2-(HydroxyMethyl)anthracene-9,10-dione | | CAS: | 17241-59-7 | | MF: | C15H10O3 | | MW: | 238.24 | | EINECS: | 241-274-3 | | Product Categories: | Anthraquinones;Chloroanthraquine, etc. | | Mol File: | 17241-59-7.mol |  |
| | 2-(HYDROXYMETHYL)ANTHRAQUINONE Chemical Properties |
| Melting point | 192-197 °C(lit.) | | Boiling point | 340.83°C (rough estimate) | | density | 1.2068 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | chloroform/methanol: soluble2%, clear to slightly hazy, colorless to yellow | | form | Solid | | pka | 14.05±0.10(Predicted) | | color | light yellow | | BRN | 2120452 | | InChI | 1S/C15H10O3/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-7,16H,8H2 | | InChIKey | JYKHAJGLEVKEAA-UHFFFAOYSA-N | | SMILES | OCc1ccc2C(=O)c3ccccc3C(=O)c2c1 | | LogP | 2.200 (est) | | CAS DataBase Reference | 17241-59-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | CB7600000 | | F | 8 | | HS Code | 29146990 | | Storage Class | 11 - Combustible Solids |
| | 2-(HYDROXYMETHYL)ANTHRAQUINONE Usage And Synthesis |
| Chemical Properties | yellowish to brown crystalline powder | | Uses | 2-(Hydroxymethyl)anthraquinone (a photoremovable protecting group) was used to chemically cage (Z)-11-hexadecen-1-ol (sex pheromone of Chilo infuscatellus snellen). | | Definition | ChEBI: 2-(hydroxymethyl)anthraquinone is an anthraquinone. It has a role as a metabolite. |
| | 2-(HYDROXYMETHYL)ANTHRAQUINONE Preparation Products And Raw materials |
|