- 2-Fluorobenzyl bromide
-
- $100.00 / 1KG
-
2025-09-25
- CAS:446-48-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 2-Fluorobenzyl bromide
-
- $0.00 / 1KG
-
2022-02-22
- CAS:446-48-0
- Min. Order: 1KG
- Purity: 99.4%
- Supply Ability: 100 tons
- 2-Fluorobenzyl bromide
-
- $1.00 / 1KG
-
2019-07-06
- CAS:446-48-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: Customzied
|
| | 2-Fluorobenzyl bromide Basic information |
| | 2-Fluorobenzyl bromide Chemical Properties |
| Boiling point | 84-85 °C15 mm Hg(lit.) | | density | 1.567 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.552(lit.) | | Fp | 181 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | Specific Gravity | 1.567 | | color | Clear colorless to slightly yellow | | Sensitive | Lachrymatory | | BRN | 1099894 | | InChI | InChI=1S/C7H6BrF/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 | | InChIKey | FFWQLZFIMNTUCZ-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=CC=C1F | | CAS DataBase Reference | 446-48-0(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Fluorobenzyl bromide(446-48-0) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 23-26-27-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B
STOT SE 3 |
| | 2-Fluorobenzyl bromide Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | 2-Fluorobenzyl bromide was used:
- in the synthesis of 2-pyrrolo[2,3-d]pyrimidines
- as alkylating agent during the synthesis of 8-alkylated imidazolo[1,2-a]pyrimid-5-ones
- in the synthesis of prasugrel
|
| | 2-Fluorobenzyl bromide Preparation Products And Raw materials |
|