| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 15955137747 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:11-CYANO-1-UNDECANOIC ACID CAS:5810-18-4 Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Henan Weituxi Chemical Technology Co., Ltd.
|
| Tel: |
0371-63284658 18135795563 |
| Email: |
3905209149@qq.com |
| Products Intro: |
Product Name:11-Cyanoundecanoic Acid CAS:5810-18-4 Purity:98% Package:100mg;500mg;1g;5g;25g
|
|
| | 11-CYANO-1-UNDECANOIC ACID Basic information |
| | 11-CYANO-1-UNDECANOIC ACID Chemical Properties |
| Melting point | 57 °C | | Boiling point | 381.7±15.0 °C(Predicted) | | density | 0.984±0.06 g/cm3(Predicted) | | pka | 4.78±0.10(Predicted) | | InChI | InChI=1S/C12H21NO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-10H2,(H,14,15) | | InChIKey | YKHZGLKQBYTRHO-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCCCC#N |
| | 11-CYANO-1-UNDECANOIC ACID Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 94, p. 4991, 1972 DOI: 10.1021/ja00769a034 |
| | 11-CYANO-1-UNDECANOIC ACID Preparation Products And Raw materials |
|