| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | methyl 3-amino-2-chloro-4-methylbenzoate(WX191552S1) Basic information |
| | methyl 3-amino-2-chloro-4-methylbenzoate(WX191552S1) Chemical Properties |
| Boiling point | 316.5±37.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 1.36±0.10(Predicted) | | Appearance | Light yellow to yellow Liquid | | InChI | InChI=1S/C9H10ClNO2/c1-5-3-4-6(9(12)13-2)7(10)8(5)11/h3-4H,11H2,1-2H3 | | InChIKey | WTKVUWVCXDIMLE-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(C)C(N)=C1Cl |
| | methyl 3-amino-2-chloro-4-methylbenzoate(WX191552S1) Usage And Synthesis |
| | methyl 3-amino-2-chloro-4-methylbenzoate(WX191552S1) Preparation Products And Raw materials |
|