Glyphosate-13C2,15N manufacturers
|
| | Glyphosate-13C2,15N Basic information |
| Product Name: | Glyphosate-13C2,15N | | Synonyms: | 1,2-13C2 15N-Glyphosate;Glyphosate 13C2,15NQ: What is
Glyphosate 13C2,15N Q: What is the CAS Number of
Glyphosate 13C2,15N Q: What is the storage condition of
Glyphosate 13C2,15N Q: What are the applications of
Glyphosate 13C2,15N;Glyphosate-13C2,1?N;Glyphosate-1,2-13C2 15N in water;Clobutinol Impurity 8;Glyphosate-1,2-13C2,15N;Glyphosate 1,2-13C2 15N 100 μg/mL in Water | | CAS: | 1185107-63-4 | | MF: | C3H8NO5P | | MW: | 172.100081 | | EINECS: | | | Product Categories: | | | Mol File: | 1185107-63-4.mol |  |
| | Glyphosate-13C2,15N Chemical Properties |
| solubility | Methanol (Slightly), Water (Slightly, Heated) | | form | Solid | | color | White to Light Brown | | InChI | InChI=1S/C3H8NO5P/c5-3(6)1-4-2-10(7,8)9/h4H,1-2H2,(H,5,6)(H2,7,8,9)/i1+1,3+1,4+1 | | InChIKey | XDDAORKBJWWYJS-QZJDPFNNSA-N | | SMILES | O[13C](=O)[13CH2][15NH]CP(=O)(O)O |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Aquatic Chronic 2
Eye Dam. 1 |
| | Glyphosate-13C2,15N Usage And Synthesis |
| | Glyphosate-13C2,15N Preparation Products And Raw materials |
|