- BocNH-PEG6-CH2CH2COOH
-
- $0.00 / 1g
-
2026-01-28
- CAS:882847-13-4
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300kg
|
| | BOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID Basic information |
| Product Name: | BOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID | | Synonyms: | Boc-NH-(PEG)-COOH (22 atoms);5,8,11,14,17,20-Hexaoxa-2-azatricosanedioic acid 1-(1,1-dimethylethyl) ester;t-Boc-N-amido-PEG6-acid;t-Boc-N-amido-PEG7-acid;Boc-N-amido-PEG6-acid;t-boc-N-amido-PEG6-propionic acid;Boc-NH-(PEG)-COOH (22 atoms) Novabiochem;BOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID | | CAS: | 882847-13-4 | | MF: | C20H39NO10 | | MW: | 453.52 | | EINECS: | | | Product Categories: | peg | | Mol File: | 882847-13-4.mol |  |
| | BOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID Chemical Properties |
| storage temp. | 2-8°C | | solubility | Soluble in DMSO | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Major Application | peptide synthesis | | InChI | InChI=1S/C20H39NO10/c1-20(2,3)31-19(24)21-5-7-26-9-11-28-13-15-30-17-16-29-14-12-27-10-8-25-6-4-18(22)23/h4-17H2,1-3H3,(H,21,24)(H,22,23) | | InChIKey | FTTYOIHYERRXQB-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCOCCOCCOCCOCCOCCOCCC(O)=O |
| WGK Germany | 3 | | HS Code | 29225090 | | Storage Class | 10 - Combustible liquids |
| | BOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID Usage And Synthesis |
| Description | t-Boc-N-amido-PEG6-acid is a PEG linker containing a terminal carboxylic acid and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | Chemical Properties | Yellow liquid | | Uses | Boc-NH-PEG6-CH2CH2COOH is a cleavable ADC linker used as a linker for antibody-drug conjugates (ADC). Boc-NH-PEG6-CH2CH2COOH is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | reaction suitability | reaction type: Pegylations reagent type: cross-linking reagent | | IC 50 | Cleavable Linker; Alkyl/ether; PEGs | | References | [1] Michael J. Mcpherson, et al. Glucocorticoid receptor agonist and immunoconjugates thereof. WO2017210471A1. |
| | BOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID Preparation Products And Raw materials |
|