|
|
| | 1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILOXANE Basic information |
| Product Name: | 1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILOXANE | | Synonyms: | Dimethyltetraphenylsiloxane. 1,3-Dimethyl-1,1,3,3-tetraphenyl-disiloxane;Tetraphenyldimethyldisiloxane;1,3-Dimethyl-1,1,3,3-tetraphenylpropanedisiloxane;Bis(methyldiphenylsilyl) oxide;T 2078;1,3-dimethyl-1,1,3,3-tetraphenyl-disiloxan;1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILOXANE;1,1,3,3-TETRAPHENYLDIMETHYLDISILOXANE | | CAS: | 807-28-3 | | MF: | C26H26OSi2 | | MW: | 410.65 | | EINECS: | 212-361-3 | | Product Categories: | Siloxanes;Organometallic Reagents;Organosilicon | | Mol File: | 807-28-3.mol |  |
| | 1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILOXANE Chemical Properties |
| Melting point | 46-49 °C | | Boiling point | 215 °C | | density | 1.076 | | refractive index | 1.598 | | Fp | 193°C | | form | solid | | Specific Gravity | 1.076 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/C26H26OSi2/c1-28(23-15-7-3-8-16-23,24-17-9-4-10-18-24)27-29(2,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3 | | InChIKey | RFGGTTPASBFBTB-UHFFFAOYSA-N | | SMILES | [Si](C)(C1=CC=CC=C1)(C1=CC=CC=C1)O[Si](C)(C1=CC=CC=C1)C1=CC=CC=C1 | | EPA Substance Registry System | Disiloxane, 1,3-dimethyl-1,1,3,3-tetraphenyl- (807-28-3) |
| | 1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILOXANE Usage And Synthesis |
| Chemical Properties | Colorless or yellowish transparent liquid | | Toxics Screening Level | The ITSL for tetraphenyldimethyldisiloxane is 0.1 μg/m3 based on an annual averaging time. |
| | 1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILOXANE Preparation Products And Raw materials |
| Raw materials | 1,1,3,5,5-Pentaphenyl-1,3,5-trimethyltrisiloxane | | Preparation Products | 1,3,5,7-tetramethyl-1,1,3,5,7,7-hexaphenyltetrasiloxane-->hydroxymethyldiphenylsilane-->1,2-DIMETHYL-1,1,2,2-TETRAPHENYLDISILANE-->Hexamethyldisiloxane |
|