|
|
| | 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane Basic information |
| Product Name: | 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane | | Synonyms: | 3,6,9-triethyl-3,6,9-trimethyl-1,2,4,5,7,8-hexaoxonane;3,6,9-TRIETHYL-3,6,9-TRIMETHYL-1,4,7-TRIPEROXYNONANE;2,4,5,7,-hexoxonane,3,6,9-triethyl-3,6,9-trimethyl-1;3,6,9-triethyl-3,6,9-trimethyl-1,4,7-triperoxynonane,41%sol.inarom.freemin.spirit;3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane;Trigonox?301;41%Sol.inarom.freemin.spirit;3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane, 41% solution in aromatic free mineral spirit | | CAS: | 24748-23-0 | | MF: | C12H24O6 | | MW: | 264.32 | | EINECS: | 429-320-2 | | Product Categories: | | | Mol File: | 24748-23-0.mol |  |
| | 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane Chemical Properties |
| Melting point | -20 °C | | Boiling point | 246.6±30.0 °C(Predicted) | | density | 0.875 | | vapor pressure | 4.1Pa at 25℃ | | Fp | 58 °C | | storage temp. | Refrigerator (+4°C) | | form | Solution | | color | Clear | | Water Solubility | 13.1mg/L at 20℃ | | InChI | InChI=1S/C12H24O6/c1-7-10(4)13-15-11(5,8-2)17-18-12(6,9-3)16-14-10/h7-9H2,1-6H3 | | InChIKey | KVWLLOIEGKLBPA-UHFFFAOYSA-N | | SMILES | O1C(CC)(C)OOC(CC)(C)OOC(CC)(C)O1 | | LogP | 4.84 at 20℃ | | EPA Substance Registry System | 1,2,4,5,7,8-Hexoxonane, 3,6,9-triethyl-3,6,9-trimethyl- (24748-23-0) |
| Provider | Language |
|
ACROS
| English |
| | 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane Usage And Synthesis |
| Chemical Properties | clear solution | | Uses | 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane is an efficient peroxide formulation for the production of controlled rheology polypropylene (CR-PP) in an extrusion process in the temperature range of 200-250°C. These beads form masterbatch of the liquid 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane, allowing a more accurate dosage of the peroxide to the polymer. Also, a more homogeneous distribution of the peroxide throughout the polymer is advantageous. Using the beads form formulation rather than the liquid form results in better control of the visbreaking process. 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane allows polypropylene producers great flexibility in controlling a polymer’s Melt Flow Index (MFI). Small changes in either peroxide concentration or process temperature can produce significantly different MFI’s. |
| | 3,6,9-Triethyl-3,6,9-trimethyl-1,4,7-triperoxonane Preparation Products And Raw materials |
|