| Company Name: |
Qingdao Tenglong microwave technology co., LTD. Gold
|
| Tel: |
0532-83818797 18561885118 |
| Email: |
market@tlwb.com.cn |
| Products Intro: |
Product Name:1,1,1,3,3,3-HEXAFLUOROISOPROPANOL (2-D1, 98%)
CAS:38701-73-4
Purity:98.0% Package:询问 Remarks:DLM-6190-PK
|
| Company Name: |
Shaoxing Shunbang Medical Technology Co. LTD Gold
|
| Tel: |
13355710117 |
| Email: |
214519960@qq.com |
| Products Intro: |
Product Name:1,1,1,3,3,3-Hexafluoro-2-propanol-OD
CAS:38701-73-4
Purity:99% Package:1g;5g;10g;25g;100g;500g;1kg
|
| Company Name: |
Shanghai Macklin Biochemical Co.,Ltd.
|
| Tel: |
15221275939 |
| Email: |
shenlinxing@macklin.cn |
| Products Intro: |
Product Name:1，1，1，3，3，3-Hexafluoro-2-propan(ol-d)
CAS:38701-73-4
Purity:99% (CP) Package:5g；1g
|
|
| | 1,1,1,3,3,3-HEXAFLUORO-2-PROPAN(OL-D) Basic information |
| Product Name: | 1,1,1,3,3,3-HEXAFLUORO-2-PROPAN(OL-D) | | Synonyms: | 1,1,1,3,3,3-Hexafluoro-2-propan(ol-d) 98 atom % D;1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL-OD;1,1,1,3,3,3-HEXAFLUORO-2-PROPAN(OL-D);1,1,1,3,3,3-hexafluoroisopropanol-d1;1,1,1,3,3,3-HEXAFLUOROISOPROPANOL 2-D1,;1,1,1,3,3,3-Hexafluoropropan-2-ol-d;1,1,1,3,3,3-Hexafluoroisopropanol (2-D?, 98%);1,1,1,3,3,3-Hexafluoro-2-deutero-propan-2-ol | | CAS: | 38701-73-4 | | MF: | C3H2F6O | | MW: | 168.04 | | EINECS: | | | Product Categories: | Alphabetical Listings;G-HStable Isotopes;NMR - Solvents;NMR Solvents and Reagents;NMRStable Isotopes;Stable Isotopes | | Mol File: | 38701-73-4.mol |  |
| | 1,1,1,3,3,3-HEXAFLUORO-2-PROPAN(OL-D) Chemical Properties |
| Melting point | -4 °C (lit.) | | Boiling point | 59 °C (lit.) | | density | 1.605 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.3(lit.) | | InChI | InChI=1S/C3H2F6O/c4-2(5,6)1(10)3(7,8)9/h1,10H | | InChIKey | BYEAHWXPCBROCE-UHFFFAOYSA-N | | SMILES | C(O[H])(C(F)(F)F)C(F)(F)F | | CAS Number Unlabeled | 920-66-1 |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 26-27-28-36/37/39 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Repr. 2
Skin Corr. 1A
STOT RE 2 Oral |
| | 1,1,1,3,3,3-HEXAFLUORO-2-PROPAN(OL-D) Usage And Synthesis |
| Uses | 1,1,1,3,3,3-Hexafluoro-2-propanol-OD(HFIP-OD) is the deuterated form of 1,1,1,3,3,3-Hexafluoro-2-propanol. It isused as an NMR solvent in organic chemistry and biochemistry for studying smallmolecules. |
| | 1,1,1,3,3,3-HEXAFLUORO-2-PROPAN(OL-D) Preparation Products And Raw materials |
|