| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Polyoxyethylene(5) oleylamine ether Basic information |
| Product Name: | Polyoxyethylene(5) oleylamine ether | | Synonyms: | Poly(oxy-1,2-ethanediyl), .alpha.,.alpha.-(9Z)-9-octadecenyliminodi-2,1-ethanediylbis.omega.-hydroxy-;Poly(oxy-1,2-ethandiyl), alpha,alpha′((9-octadecenylimino)di-2,1-ethandiyl)bis(omega-hydroxy-, (Z)-;Polyethyleneglycol oleylamine;oleylamine ethoxylate;(Z)-.alpha.,.alpha.'-[(9-Octadecenylimino)diethylene]bis[.omega.-hydroxypoly(oxyethylene)];.alpha.,.alpha.'-[(9-Octadecenylimino)di-2,1-ethanediyl]bis[.omega.-hydroxypoly(oxy-1,2-ethanediyl]-,(Z)-;.alpha.'-[(9-Octadecenylimino)di-2,1-ethanediyl]bis[.omega.-hydroxypoly(oxy-1,2-ethanediyl]-,(Z)-.alpha.;2-ethanediyl),.alpha.,.alpha.'-[(9-octadecenylimino)di-2,1-ethanediyl]bis[.omega.-hydroxy-,(Z)-Poly(oxy-1 | | CAS: | 26635-93-8 | | MF: | (C2H4O)n(C2H4O)nC22H45NO2 | | MW: | 387.597 | | EINECS: | 500-048-7 | | Product Categories: | | | Mol File: | 26635-93-8.mol |  |
| | Polyoxyethylene(5) oleylamine ether Chemical Properties |
| Boiling point | 300℃[at 101 325 Pa] | | density | 907[at 20℃] | | vapor pressure | 0.001Pa at 20℃ | | pka | 8.8[at 20 ℃] | | Specific Gravity | 0.94 | | Water Solubility | 5.9mg/L at 23℃ | | Cosmetics Ingredients Functions | ANTISTATIC SURFACTANT - CLEANSING CLEANSING SURFACTANT - FOAM BOOSTING SURFACTANT - EMULSIFYING | | Cosmetic Ingredient Review (CIR) | POLYOXYETHYLENE(5) OLEYLAMINE ETHER (26635-93-8) | | InChI | InChI=1S/C22H45NO4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(25)21-23(26-4-2)27-20-19-24/h11-12,22,24-25H,3-10,13-21H2,1-2H3/b12-11- | | InChIKey | AFGPHYKFPYOQIS-QXMHVHEDSA-N | | SMILES | C(O)CON(OCC)CC(O)CCCCCC/C=C\CCCCCCCC | | LogP | 3.4 at 25℃ | | EPA Substance Registry System | N-Polyethoxylated oleylamine (26635-93-8) |
| | Polyoxyethylene(5) oleylamine ether Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | Polyoxyethylene(5) oleylamine ether Preparation Products And Raw materials |
|