|
|
| | 2,6-Dichloro-3-fluoroacetophenone Basic information |
| Product Name: | 2,6-Dichloro-3-fluoroacetophenone | | Synonyms: | 2,6-DICHLORO-5-FLUORO ACETOPHENONE;2,6-DICHLORO-3-FLUOROACETOPHENONE;2',6'-Dichloro-3'-Fluoroacetophenone 3-Fluoro-2,6-Dichloroacetophenone;2,6-dichloro-3-fluro acetophenone;2',6'-DICHLORO-3'-FLUOROACETOPHENONE, 98;2',6'-Dichloro-3'-fluoroacetophenone 98%;3-Fluoro-2,6-Dichloroacetophenone;1-(2,6-DICHLORO-3-FLUOROPHENYL)ETHANONE | | CAS: | 290835-85-7 | | MF: | C8H5Cl2FO | | MW: | 207.03 | | EINECS: | | | Product Categories: | C7 to C8;Carbonyl Compounds;Ketones;Carbonyl Compounds;bc0001 | | Mol File: | 290835-85-7.mol |  |
| | 2,6-Dichloro-3-fluoroacetophenone Chemical Properties |
| Boiling point | 255 °C(lit.) | | density | 1.403 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.529(lit.) | | Fp | 255°C | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Clear colorless to light yellow | | Specific Gravity | 1.403 | | InChI | InChI=1S/C8H5Cl2FO/c1-4(12)7-5(9)2-3-6(11)8(7)10/h2-3H,1H3 | | InChIKey | VJBFZHHRVCPAPZ-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(Cl)C=CC(F)=C1Cl)C | | CAS DataBase Reference | 290835-85-7(CAS DataBase Reference) |
| Hazard Codes | Xi,F,T | | Risk Statements | 36/37/38-22-25 | | Safety Statements | 37/39-26-45 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 29143990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2,6-Dichloro-3-fluoroacetophenone Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liqui | | Uses | 2,6-Dichloro-3-fluoroacetophenone is a halogenated derivative of Acetophenone (A164015), a reagent used in the production of fragrances and resin polymers. | | Uses | 2′,6′-Dichloro-3′-fluoroacetophenone (2,6-Dichloro-3-fluoroacetophenone) may be used to synthesize the enantiomerically pure form of (S)-1-(2,6-dichloro-3-fluorophenyl)ethanol. | | General Description | 2′,6′-Dichloro-3′-fluoroacetophenone is an aryl fluorinated building block. |
| | 2,6-Dichloro-3-fluoroacetophenone Preparation Products And Raw materials |
|