|
|
| | 3-(Methylthio)propyl acetate Basic information |
| Product Name: | 3-(Methylthio)propyl acetate | | Synonyms: | methionol acetate;FEMA 3883;3-(METHYLTHIO)PROPYL ACETATE;3-ACETOXYPROPYL METHYL SULFIDE;3-MEHTYLTHIO PROPYL ACETATE;1-Propanol, 3-(methylthio)-, acetate;3-(Methylmercapto)-propyl acetate;3-(METHYLTHIO)-1-PROPANOACETATE | | CAS: | 16630-55-0 | | MF: | C6H12O2S | | MW: | 148.22 | | EINECS: | 240-679-2 | | Product Categories: | sulfide Flavor | | Mol File: | 16630-55-0.mol |  |
| | 3-(Methylthio)propyl acetate Chemical Properties |
| Boiling point | 96°C/14mmHg(lit.) | | density | 1.041 g/cm3 | | FEMA | 3883 | 3-(METHYLTHIO)PROPYL ACETATE | | refractive index | 1.4610-1.4650 | | storage temp. | 2-8°C, stored under nitrogen | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 0.10 % in propylene glycol. herbal mushroom cabbage asparagus potato cheesy | | Odor Type | sulfurous | | JECFA Number | 478 | | InChI | InChI=1S/C6H12O2S/c1-6(7)8-4-3-5-9-2/h3-5H2,1-2H3 | | InChIKey | LPZQTNIAYMRVMF-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)CCSC | | LogP | 1.30 | | NIST Chemistry Reference | 1-Propanol, 3-(methylthio)-, acetate(16630-55-0) |
| | 3-(Methylthio)propyl acetate Usage And Synthesis |
| Occurrence | Reported found in apple, melon, pineappple, beer, malt whiskey and white wine. | | Uses | 3-(Methylthio)propyl Acetate is liquid cleaning compound with optimized scent. Also, is perfume compound comprising fragrance modulator compounds and 1-Aza-3,7-dioxabicyclo[3.3.0]octane compounds for increasing and prolonging the intensity of fragrance. | | Definition | ChEBI: 3-methylthiopropyl acetate is an acetate ester obtained by the formal condensation of the hydroxy group of 3-(methylsulfanyl)propan-1-ol with acetic acid. It has a role as a metabolite. It is an acetate ester and a methyl sulfide. It is functionally related to a 3-methylthiopropanol. | | Aroma threshold values | Detection: 30 ppb |
| | 3-(Methylthio)propyl acetate Preparation Products And Raw materials |
|