|
|
| | Quinoline-7-carbaldehyde Basic information |
| | Quinoline-7-carbaldehyde Chemical Properties |
| Melting point | 85.0 to 88.0 °C | | Boiling point | 314.3±15.0 °C(Predicted) | | density | 1.223±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | pka | 3.06±0.14(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C10H7NO/c12-7-8-3-4-9-2-1-5-11-10(9)6-8/h1-7H | | InChIKey | WINWAFCAQPFBQA-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(C=O)C=2)C=CC=1 | | CAS DataBase Reference | 49573-30-0(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29334900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Quinoline-7-carbaldehyde Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 7-Quinolinecarbaldehyde is a reagent used in pharmaceutical synthesis, including Hepatitis C NS5A inhibitors as well as antitumor agents and benzothiazole Schiff bases. |
| | Quinoline-7-carbaldehyde Preparation Products And Raw materials |
|