- N-Boc-2-pyrroleboronic acid
-
- $15.00 / 1KG
-
2021-07-13
- CAS:135884-31-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- N-Boc-2-pyrroleboronic acid
-
- $15.00 / 1KG
-
2021-07-10
- CAS:135884-31-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | N-Boc-2-pyrroleboronic acid Basic information |
| | N-Boc-2-pyrroleboronic acid Chemical Properties |
| Melting point | 93-98 °C (dec.) (lit.) | | Boiling point | 361.4±52.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform, Ethyl Acetate | | form | powder | | pka | 8.47±0.53(Predicted) | | color | gray solid | | BRN | 7993875 | | InChI | InChI=1S/C9H14BNO4/c1-9(2,3)15-8(12)11-6-4-5-7(11)10(13)14/h4-6,13-14H,1-3H3 | | InChIKey | ZWGMJLNXIVRFRJ-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C=CC=C1B(O)O | | CAS DataBase Reference | 135884-31-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Irritant | | TSCA | No | | HazardClass | KEEP COLD | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | N-Boc-2-pyrroleboronic acid Usage And Synthesis |
| Chemical Properties | beige to light brown crystalline powder | | Uses | suzuki reaction |
| | N-Boc-2-pyrroleboronic acid Preparation Products And Raw materials |
|