α-Ketoglutaric acid sodium salt manufacturers
|
| | α-Ketoglutaric acid sodium salt Basic information |
| Product Name: | α-Ketoglutaric acid sodium salt | | Synonyms: | A-KETOGLUTARIC ACID, SODIUM SALT;ALPHA-KETOGLUTARIC ACID SODIUM SALT;ALPHA-KETOGLUTARIC ACID MONOSODIUM SALT;Pentanedioic acid,2-oxo-, sodium salt (1:1);2-OXOPENTANEDIOIC ACID MONOSODIUM SALT;2-OXOGLUTARIC ACID MONOSODIUM SALT;2-KETOGLUTARIC ACID MONOSODIUM SALT;sodium hydrogen 2-oxoglutarate | | CAS: | 22202-68-2 | | MF: | C5H5NaO5 | | MW: | 168.08 | | EINECS: | 244-836-6 | | Product Categories: | | | Mol File: | 22202-68-2.mol |  |
| | α-Ketoglutaric acid sodium salt Chemical Properties |
| storage temp. | 2-8°C | | solubility | H2O: 0.5 M at 20 °C, clear, colorless | | form | Powder | | color | White | | Water Solubility | water: 100mg/mL, clear, colorless | | BRN | 4597521 | | Stability: | Hygroscopic | | InChI | 1S/C5H6O5.Na/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+1/p-1 | | InChIKey | MOTOGHHLNTXPTI-UHFFFAOYSA-M | | SMILES | [Na+].OC(=O)CCC(=O)C([O-])=O |
| | α-Ketoglutaric acid sodium salt Usage And Synthesis |
| Uses | α-Ketoglutaric acid sodium salt has been used in the human kynurenine amino transferase II (KAT II) inhibition spectra assay. | | Biochem/physiol Actions | α-Ketoglutaric acid is the precursor for L-glutamic acid. | | IC 50 | Human Endogenous Metabolite; Microbial Metabolite; Tyrosinase: 15 mM (IC50) |
| | α-Ketoglutaric acid sodium salt Preparation Products And Raw materials |
|