|
|
| | Benproperine phosphate Basic information |
| | Benproperine phosphate Chemical Properties |
| Melting point | 150-152° | | storage temp. | Refrigerator | | solubility | DMSO (Slightly, Heated), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C21H27NO.H3O4P/c1-18(22-14-8-3-9-15-22)17-23-21-13-7-6-12-20(21)16-19-10-4-2-5-11-19;1-5(2,3)4/h2,4-7,10-13,18H,3,8-9,14-17H2,1H3;(H3,1,2,3,4) | | InChIKey | MCVUURBOSHQXMK-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1OCC(C)N1CCCCC1)CC1=CC=CC=C1.P(=O)(O)(O)O | | CAS DataBase Reference | 19428-14-9(CAS DataBase Reference) |
| Toxicity | LD50 orally in mice: 1431 mg/kg (Tellini, De Fina) |
| | Benproperine phosphate Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An antitussive. | | in vivo | Benproperine phosphate (50, 100mg/kg; oral gavage; 5days per week for 4weeks) inhibits primary pancreatic tumor growth[1].
Benproperine phosphate shows a marked decrease in the lung metastasis of AsPC-1 cells (56.1% inhibition) in mouse. Benproperine phosphate significantly suppressed the liver metastasis of HCT-116 cells by 78.9% and DLD-1 cells by 78.2%[1].
| Animal Model: | Female BALB/c nude mice of 6-week-old with AsPC-1 cells[1] | | Dosage: | 50, 100mg/kg | | Administration: | Oral gavage; 5days per week for 4weeks | | Result: | Inhibited primary pancreatic tumor growth compared to the vehicle control (47.7% inhibition) without body weights change.
|
|
| | Benproperine phosphate Preparation Products And Raw materials |
|