|
|
| | 1,3-Adamantanediacetic acid Basic information |
| | 1,3-Adamantanediacetic acid Chemical Properties |
| Melting point | 234-237 °C (lit.) | | Boiling point | 453.9±18.0 °C(Predicted) | | density | 1.304±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | very faint turbidity in hot Methanol | | pka | 4.42±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C14H20O4/c15-11(16)6-13-2-9-1-10(4-13)5-14(3-9,8-13)7-12(17)18/h9-10H,1-8H2,(H,15,16)(H,17,18) | | InChIKey | UTENGZNBNPABQE-UHFFFAOYSA-N | | SMILES | C12(CC(O)=O)CC3CC(CC(CC(O)=O)(C3)C1)C2 | | CAS DataBase Reference | 17768-28-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29172090 |
| | 1,3-Adamantanediacetic acid Usage And Synthesis |
| | 1,3-Adamantanediacetic acid Preparation Products And Raw materials |
|