BETA-CHLOROLACTIC ACID manufacturers
|
| | BETA-CHLOROLACTIC ACID Basic information |
| | BETA-CHLOROLACTIC ACID Chemical Properties |
| Melting point | 77 °C | | Boiling point | 259.5±20.0 °C(Predicted) | | density | 1.519±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Very Slightly), DMSO (Slightly), Methanol (Sparingly) | | pka | 3.23±0.11(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C3H5ClO3/c4-1-2(5)3(6)7/h2,5H,1H2,(H,6,7) | | InChIKey | OSLCJYYQMKPZHU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(O)CCl | | EPA Substance Registry System | 3-Chlorolactic acid (1713-85-5) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | 1759 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | BETA-CHLOROLACTIC ACID Usage And Synthesis |
| Description | β-Chlorolactic acid, also known as 3-Chloro-2-hydroxypropanoic acid, is a major intermediate of 3-monochloro-1,2-propanediol (MCPD) in mammals, and a by-product of acid hydrolysis in the production of soy sauce. Studies have shown that β-chlorolactic acid may have immunotoxic effects on the immune response of lymphocytes and peritoneal macrophages in vitro. | | Chemical Properties | White Solid | | Uses | 3-Chloro-2-hydroxypropanoic acid-13C3 (2-Hydroxy-3-chloropropionic Acid-13C3) is 13C labeled 3-Chloro-2-hydroxypropanoic acid[1]. | | Definition | ChEBI: 3-chlorolactic acid is a 2-hydroxy monocarboxylic acid that is lactic acid in which one of the methyl hydrogens is replaced by a chloro group. It is a 2-hydroxy monocarboxylic acid and an organochlorine compound. It is functionally related to a rac-lactic acid. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
| | BETA-CHLOROLACTIC ACID Preparation Products And Raw materials |
|