| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | (R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol Basic information | | Uses |
| Product Name: | (R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol | | Synonyms: | (R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol;(R)-4,4'-dibromo-7,7'-dimethoxy-2,2',3,3'-tetrahydro-1,1'-spirobi[indene];1,1'-Spirobi[1H-indene]-7,7'-diol, 4,4'-dibromo-2,2',3,3'-tetrahydro-, (1R)- (9CI);(R)-4,4'-Dibromo-7,7'-dihydroxy-1,1'-spirobiindane;(R)-4,4'-Dibromo-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-7,7'-diol | | CAS: | 681481-94-7 | | MF: | C17H14Br2O2 | | MW: | 410.1 | | EINECS: | | | Product Categories: | | | Mol File: | 681481-94-7.mol |  |
| | (R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol Chemical Properties |
| Melting point | 161 °C | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C17H14Br2O2/c18-11-1-3-13(20)15-9(11)5-7-17(15)8-6-10-12(19)2-4-14(21)16(10)17/h1-4,20-21H,5-8H2 | | InChIKey | OZVMVFKUNSNXQC-UHFFFAOYSA-N | | SMILES | [C@@]12(C3=C(C(Br)=CC=C3O)CC1)C1=C(C(Br)=CC=C1O)CC2 |
| | (R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol Usage And Synthesis |
| Uses | (R)-4,4'-dibromo-1,1'-spirodiindan-7,7'-diol is a heterocyclic derivative that can be used as an intermediate in organic synthesis. |
| | (R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol Preparation Products And Raw materials |
|