- 4-Chlorochalcone
-
- $0.00 / 10g
-
2020-02-26
- CAS: 956-04-7
- Min. Order: 10g
- Purity: 99.0%+
- Supply Ability: 100 tons
- 4-Chlorochalcone
-
- $0.00 / 1Kg
-
2020-02-26
- CAS: 956-04-7
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | 4-Chlorochalcone Basic information | | Uses |
| Product Name: | 4-Chlorochalcone | | Synonyms: | 3-(4-chlorophenyl)-1-phenyl-2-propen-1-on;JRH-08103, (E)-3-(4-Chlorophenyl)-1-phenylprop-2-en-1-one, 97%;4-CHLOROBENZYLIDENE ACETOPHENONE;3-(4-chlorophenyl)-1-phenyl-2-propen-1-one;4-chloro-chalcon;4-chlorostyrylphenylketone;p-chlorochalcone;1-(4-Chlorophenyl)-3-phenyl-1-propene-3-one | | CAS: | 956-04-7 | | MF: | C15H11ClO | | MW: | 242.7 | | EINECS: | 213-476-1 | | Product Categories: | Chalcones;C15 to C38;Carbonyl Compounds;Ketones | | Mol File: | 956-04-7.mol |  |
| | 4-Chlorochalcone Chemical Properties |
| Melting point | 113-117 °C (lit.) | | Boiling point | 345.7°C (rough estimate) | | density | 1.1255 (rough estimate) | | refractive index | 1.5220 (estimate) | | storage temp. | Store at room temperature | | form | solid | | Appearance | Off-white to light yellow Solid | | BRN | 1105953 | | InChI | InChI=1S/C15H11ClO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H | | InChIKey | ABGIIXRNMHUKII-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)C=CC1=CC=C(Cl)C=C1 | | CAS DataBase Reference | 956-04-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | RTECS | UD5572994 | | Hazard Note | Irritant | | HS Code | 2914790090 | | Storage Class | 11 - Combustible Solids |
| | 4-Chlorochalcone Usage And Synthesis |
| Uses | 4-Chlorochalcone belongs to the ketone derivative class and can be used as a pharmaceutical synthesis intermediate. | | Uses | 4-Chlorochalcone is a chalcone derivative. Its crystals exhibit monoclinic system with space group P21/c. It can undergo conjugate addition reaction with pyrrole in the presence of AlKIT-5 (mesoporous 3D aluminosilicate catalyst) to form the corresponding C2-alkylated pyrrole derivatives. | | Definition | ChEBI: A member of the class of chalcones that is trans-chalcone substituted by a chloro group at position 4. | | Synthesis Reference(s) | Tetrahedron Letters, 28, p. 4541, 1987 DOI: 10.1016/S0040-4039(00)96558-4 | | General Description | 4-Chlorochalcone is a chalcone derivative. Its crystals exhibit monoclinic system with space group P21/c. It can undergo conjugate addition reaction with pyrrole in the presence of AlKIT-5 (mesoporous 3D aluminosilicate catalyst) to form the corresponding C2-alkylated pyrrole derivatives. |
| | 4-Chlorochalcone Preparation Products And Raw materials |
|