6-AMINO-2-METHYLQUINOLINE manufacturers
|
| | 6-AMINO-2-METHYLQUINOLINE Basic information |
| | 6-AMINO-2-METHYLQUINOLINE Chemical Properties |
| Melting point | 186-188 °C | | Boiling point | 273.29°C (rough estimate) | | density | 1.1192 (rough estimate) | | refractive index | 1.6392 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 6.47±0.43(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Green | | Water Solubility | Soluble in water. | | BRN | 114795 | | InChI | InChI=1S/C10H10N2/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-6H,11H2,1H3 | | InChIKey | TYJFYUVDUUACKX-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(N)=CC=2)C=CC=1C | | CAS DataBase Reference | 65079-19-8(CAS DataBase Reference) | | EPA Substance Registry System | 6-Quinolinamine, 2-methyl- (65079-19-8) |
| | 6-AMINO-2-METHYLQUINOLINE Usage And Synthesis |
| Chemical Properties | brown fine powder | | Uses | 6-Amino-2-methylquinoline is used as an organic chemical synthesis intermediate. |
| | 6-AMINO-2-METHYLQUINOLINE Preparation Products And Raw materials |
|