N,N-Bis(2-hydroxyethyl)ethylenediamine manufacturers
|
| | N,N-Bis(2-hydroxyethyl)ethylenediamine Basic information |
| | N,N-Bis(2-hydroxyethyl)ethylenediamine Chemical Properties |
| Melting point | 92 °C | | Boiling point | 110 °C0.02 mm Hg(lit.) | | density | 1.069 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.498(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | Liquid | | pka | 14.38±0.10(Predicted) | | Specific Gravity | 1.069 | | Appearance | Light yellow to yellow Liquid | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C6H16N2O2/c7-1-2-8(3-5-9)4-6-10/h9-10H,1-7H2 | | InChIKey | CYOIAXUAIXVWMU-UHFFFAOYSA-N | | SMILES | N(CCO)(CCO)CCN |
| Hazard Codes | C | | Risk Statements | 34-37 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III |
| | N,N-Bis(2-hydroxyethyl)ethylenediamine Usage And Synthesis |
| Uses | It is employed as pharmaceutical intermediate. |
| | N,N-Bis(2-hydroxyethyl)ethylenediamine Preparation Products And Raw materials |
|