| Company Name: |
Tianjin heowns Biochemical Technology Co., Ltd.
|
| Tel: |
400 638 7771 |
| Email: |
sales@heowns.com |
| Products Intro: |
Product Name:MagnesiuM Inophore I
CAS:75513-72-3
Purity:Selectophore, function tested Package:1g;5g;25g;100g;500g;1000g
|
| Company Name: |
Suzhou Laing Biological Technology Co., LTD
|
| Tel: |
0512-62968256 18550502935 |
| Email: |
export@laingbiotec.com |
| Products Intro: |
Product Name:N,N'-diheptyl-N,N'-diMethyl-ButanediaMide
CAS:75513-72-3
Purity:97%+ Package:10g;100g
|
| Company Name: |
Tianjin Being Technology Co., Ltd.
|
| Tel: |
18622939839 |
| Email: |
tjby921@163.com |
| Products Intro: |
Product Name:N,N'-diheptyl-N,N'-diMethyl-ButanediaMide
CAS:75513-72-3
Purity:95% Package:1g;5g;10g;100g;1kg
|
|
| | ETH 1117 Basic information |
| Product Name: | ETH 1117 | | Synonyms: | ETH 1117;MAGNESIUM IONOPHORE I;MAGNESIUM IONOPHORE I - COCKTAIL A;MAGNESIUM-LIGAND;N,N'-DIHEPTYL-N,N'-DIMETHYL-1,4-BUTANEDIAMIDE;TIMTEC-BB SBB009103;ETH 1117, Magnesium-ligand, N,Nμ-Diheptyl-N,Nμ-dimethyl-1,4-butanediamide;N,N'-Diheptyl-N,N'-dimethylbutanediamide | | CAS: | 75513-72-3 | | MF: | C20H40N2O2 | | MW: | 340.54 | | EINECS: | | | Product Categories: | M;Stains and Dyes;Stains&Dyes, A to;Analytical/Chromatography;Ion Sensor Materials;Ionophore Cocktails | | Mol File: | 75513-72-3.mol |  |
| | ETH 1117 Chemical Properties |
| Boiling point | 464.7±28.0 °C(Predicted) | | density | 0.926±0.06 g/cm3(Predicted) | | form | liquid | | pka | -0.23±0.70(Predicted) | | BRN | 6408855 | | InChI | 1S/C20H40N2O2/c1-5-7-9-11-13-17-21(3)19(23)15-16-20(24)22(4)18-14-12-10-8-6-2/h5-18H2,1-4H3 | | InChIKey | CBEVANLIGJVSHZ-UHFFFAOYSA-N | | SMILES | CCCCCCCN(C)C(=O)CCC(=O)N(C)CCCCCCC |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | ETH 1117 Usage And Synthesis |
| Uses | Magnesium ionophore I (ETH 1117) serves as the primary component for the development of calcium-magnesium selective electrodes. | | Purification Methods | Purify it by flash chromatography (at 40 kPa) on silica and eluting with EtOH/hexane (4:1). IR has (CHCl3) 1630cm-1. [Eene et al. Helv Chim Acta 63 2271 1980.] Itisa good magnesium selectophore compared with Na, K and Ca [Lanter et al. Anal Chem 52 2400 1980]. |
| | ETH 1117 Preparation Products And Raw materials |
|