|
|
| | FMOC-L-CYCLOPROPYLGLYCINE Basic information |
| Product Name: | FMOC-L-CYCLOPROPYLGLYCINE | | Synonyms: | FMOC-L-CYCLOPROPYLGLYCINE;L-2-Cyclopropylglycine, N-FMOC protected, (S)-Cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid;(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclopropylacetic acid;(2S)-2-cyclopropyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid;(S)-Fmoc-cyclopropylglycine;(alphaS)-alpha-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopropaneacetic acid;Fmoc-(S)-Amino-cyclopropyl-acetic acid;Fmoc-L-cyclopropylglycine≥ 99% (HPLC, Chiral purity) | | CAS: | 1212257-18-5 | | MF: | C20H19NO4 | | MW: | 337.37 | | EINECS: | | | Product Categories: | Unusual amino acids;a-amino | | Mol File: | Mol File |  |
| | FMOC-L-CYCLOPROPYLGLYCINE Chemical Properties |
| Boiling point | 577.1±33.0 °C(Predicted) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.85±0.10(Predicted) | | form | powder | | color | White | | Optical Rotation | 17.134°(C=0.01g/ml DCM) | | InChI | InChI=1S/C20H19NO4/c22-19(23)18(12-9-10-12)21-20(24)25-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17-18H,9-11H2,(H,21,24)(H,22,23)/t18-/m0/s1 | | InChIKey | YMLZBPTXRMNAFP-SFHVURJKSA-N | | SMILES | C1(COC(=O)N[C@H](C(O)=O)C2CC2)C2C=CC=CC=2C2C=CC=CC=21 |
| Hazard Codes | Xi | | HS Code | 2922498590 |
| | FMOC-L-CYCLOPROPYLGLYCINE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-L-cyclopropylglycine is used in preparation of tailored Cyclodepsipeptides as potent non-covalent serine protease inhibitors. | | Synthesis | GENERAL STEPS: 2.3 g of Na2CO3 was dissolved in 34 mL of water and chloroformic acid-9-fluorenylmethyl ester and (S)-2-amino-2-cyclopropylacetic acid were added with stirring. The reaction mixture was stirred at room temperature. After completion of the reaction, the product was characterized by FT-IR and NMR.FT-IR (pure): 2669, 2335, 2159, 2106, 1785, 1689, 1550, 1489, 1463, 1433, 1369, 1296, 1253, 1172, 1128, 1001 cm^-1.^1H NMR ( CDCl3, 600 MHz): δ = 7.76 (d, 2H, J = 7.2 Hz), 7.60-7.59 (m, 2H), 7.41-7.39 (m, 2H), 7.32-7.30 (m, 2H), 5.36 (d, 1H, J = 6 Hz), 4.45-4.39 (m, 2H), 4.24-4.21 (m, 1H ), 3.83-3.81 (m, 1H), 1.14-1.13 (m, 1H), 0.65-0.46 (m, 5H) ppm. ^13C NMR (CDCl3, 150 MHz): δ = 176.6, 156.2, 143.9, 143.8, 141.4, 127.9, 127.2, 125.2, 125.1 , 120.1, 67.3, 57.4, 47.3, 13.9, 3.4 ppm. HRMS (ESI): m/z [M + Na]^+ Calculated value C20H19NO4Na 360.1206, measured value 360.1193. | | References | [1] Journal of the American Chemical Society, 2016, vol. 138, # 5, p. 1698 - 1708
[2] Patent: WO2016/138288, 2016, A1. Location in patent: Page/Page column 124 |
| | FMOC-L-CYCLOPROPYLGLYCINE Preparation Products And Raw materials |
|