|
|
| | 5-GERANOXY-7-METHOXYCOUMARIN Basic information |
| Product Name: | 5-GERANOXY-7-METHOXYCOUMARIN | | Synonyms: | COUMARIN-5[(3,7 DIMETHYL 2,6 OCTADIENYL) OXY]-7-METHOXY;GERANOXY-7-METHOXYCOUMARIN, 5-;5-GERANOXY-7-METHOXYCOUMARIN;5-GERANYLOXY-7-METHOXYCOUMARIN;5[(3,7-DIMETHYL-2,6-OCTADIENYL)OXY]-7-METHOXYCOUMARIN;5-GERANOXY-7-METHOXYCOUMARIN WITH HPLC;5-GERANYLOXY-7-METHOXYCOUMARIN hplc;2H-1-Benzopyran-2-one, 5-((3,7-dimethyl-2,6-octadienyl)oxy)-7-methoxy-, (E)- | | CAS: | 7380-39-4 | | MF: | C20H24O4 | | MW: | 328.4 | | EINECS: | | | Product Categories: | Coumarins | | Mol File: | 7380-39-4.mol |  |
| | 5-GERANOXY-7-METHOXYCOUMARIN Chemical Properties |
| Melting point | 86-88°C | | storage temp. | -20°C | | InChI | 1S/C20H24O4/c1-14(2)6-5-7-15(3)10-11-23-18-12-16(22-4)13-19-17(18)8-9-20(21)24-19/h6,8-10,12-13H,5,7,11H2,1-4H3/b15-10+ | | InChIKey | WXUOSNJWDJOHGW-XNTDXEJSSA-N | | SMILES | O=C1OC2=CC(OC)=CC(OC/C=C(C)/CCC=C(C)C)=C2C=C1 | | LogP | 5.970 (est) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-GERANOXY-7-METHOXYCOUMARIN Usage And Synthesis |
| Uses | 5-Geranoxy-7-methoxycoumarin is a coumarin with anti-cancer, antifungal, and antibacterialactivities. 5-Geranoxy-7-methoxycoumarin induces cell apoptosis[1][2]. | | Definition | ChEBI: 5-Geranyloxy-7-methoxycoumarin is a terpene lactone. | | References | [1] Jaiprakash R Patil, et al. 5-Geranyloxy-7-methoxycoumarin inhibits colon cancer (SW480) cells growth by inducing apoptosis. Planta Med. 2013 Mar;79(3-4):219-26. DOI:10.1055/s-0032-1328130
[2] Guo-Ying Zuo, et al. Synergism of coumarins from the Chinese drug Zanthoxylum nitidum with antibacterial agents against methicillin-resistant Staphylococcus aureus (MRSA). Phytomedicine DOI:10.1016/j.phymed.2016.11.001 |
| | 5-GERANOXY-7-METHOXYCOUMARIN Preparation Products And Raw materials |
|