2-Fluoro-5-formylphenylboronic acid manufacturers
|
| | 2-Fluoro-5-formylphenylboronic acid Basic information |
| | 2-Fluoro-5-formylphenylboronic acid Chemical Properties |
| Melting point | 168-171°C | | storage temp. | Store at room temperature | | form | powder | | color | White | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H6BFO3/c9-7-2-1-5(4-10)3-6(7)8(11)12/h1-4,11-12H | | InChIKey | SQSWYWCEKCVQEA-UHFFFAOYSA-N | | SMILES | B(C1=CC(C=O)=CC=C1F)(O)O | | CAS DataBase Reference | 352534-79-3(CAS DataBase Reference) |
| | 2-Fluoro-5-formylphenylboronic acid Usage And Synthesis |
| Chemical Properties | Off-white Cryst |
| | 2-Fluoro-5-formylphenylboronic acid Preparation Products And Raw materials |
|