|
|
| | 4-Methoxy-2-nitrophenol Basic information |
| | 4-Methoxy-2-nitrophenol Chemical Properties |
| Melting point | 78-80 °C (lit.) | | Boiling point | 298.4°C (rough estimate) | | density | 1.3375 (estimate) | | refractive index | 1.5830 (rough estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in methanol almost transparency. | | pka | 7.33±0.14(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | Henry's Law Constant | 5.3×100 mol/(m3Pa) at 25℃, Tremp et al. (1993) | | InChI | 1S/C7H7NO4/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,9H,1H3 | | InChIKey | YBUGOACXDPDUIR-UHFFFAOYSA-N | | SMILES | COc1ccc(O)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 1568-70-3(CAS DataBase Reference) | | NIST Chemistry Reference | Phenol, 4-methoxy-2-nitro-(1568-70-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | HS Code | 29095000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Methoxy-2-nitrophenol Usage And Synthesis |
| Chemical Properties | orange-brown powder and chunks | | Uses | 4-Methoxy-2-nitrophenol can treat obesity, prevent weight gain, promote weight loss, promote slimming, or treat or prevent the development of diabetes. |
| | 4-Methoxy-2-nitrophenol Preparation Products And Raw materials |
|