- 4-Phenyl-2-pyrrolidinone
-
- $200.00 / 1KG
-
2025-09-25
- CAS:1198-97-6
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
- 4-Phenyl-2-pyrrolidone
-
- $1400.00 / 1Kg/Bag
-
2025-06-20
- CAS:1198-97-6
- Min. Order: 1Kg/Bag
- Purity: 97%
- Supply Ability: 50KG/MONTH
|
| | 4-Phenyl-2-pyrrolidinone Basic information |
| Product Name: | 4-Phenyl-2-pyrrolidinone | | Synonyms: | 4-phenyl-2-pyrrolidinon;2-tert-butyl-4,6-dinitro-N-(2,4,6-tribromophenyl)aniline;4-Phenylpyrrolidin-2-one 95%;4-phenylpyrrolidone-2;4-PHENYL-2-PYRROLIDINONE;4-Phenyl-2-pyrrolidone;4-PHENYL-2-PYRIOLIDONE;4-phenylpyrrolidin-2-one | | CAS: | 1198-97-6 | | MF: | C10H11NO | | MW: | 161.2 | | EINECS: | | | Product Categories: | | | Mol File: | 1198-97-6.mol |  |
| | 4-Phenyl-2-pyrrolidinone Chemical Properties |
| Melting point | 72.0～78.0℃ | | Boiling point | 287.51°C (rough estimate) | | density | 1.0840 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 16.13±0.40(Predicted) | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C10H11NO/c12-10-6-9(7-11-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12) | | InChIKey | HOJZEMQCQRPLQQ-UHFFFAOYSA-N | | SMILES | N1CC(C2=CC=CC=C2)CC1=O |
| | 4-Phenyl-2-pyrrolidinone Usage And Synthesis |
| Uses | is used in the preparation of oxotremorine analogs as muscarinic antagonists. Also used in the synthesis of purrolidinylidemeureas as agents that act on the CNS. |
| | 4-Phenyl-2-pyrrolidinone Preparation Products And Raw materials |
|