| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:ACENAPHTHYLENE D8 CAS:93951-97-4 Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
ACENAPHTHYLENE D8 manufacturers
- Acenaphthylene-d8
-
- $0.00 / 5mg
-
2026-01-04
- CAS:93951-97-4
- Min. Order:
- Purity:
- Supply Ability: 10g
- ACENAPHTHYLENE D8
-
- $1.00 / 1g
-
2020-01-10
- CAS:93951-97-4
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | ACENAPHTHYLENE D8 Basic information |
| Product Name: | ACENAPHTHYLENE D8 | | Synonyms: | ACENAPHTHYLENE D8;Acenaphylthene-d8;ACENAPHTHYLENE-D8, 99 ATOM % D;Acenaphthylene-1,2,3,4,5,6,7,8-d8;Acenaphthylene-d8;1,2,3,4,5,6,7,8-octadeuterioacenaphthylene;Acenaphthylene-1,2,3,4,5,6,7,8-d8;Acenaphtylene-d8Solution,10mg/L,1ml | | CAS: | 93951-97-4 | | MF: | C12D8 | | MW: | 160.24 | | EINECS: | | | Product Categories: | A;Alphabetical Listings;Stable Isotopes | | Mol File: | 93951-97-4.mol |  |
| | ACENAPHTHYLENE D8 Chemical Properties |
| Melting point | 92-95 °C(lit.) | | Boiling point | 280 °C(lit.) | | Fp | 122℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Yellow | | InChI | 1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D | | InChIKey | HXGDTGSAIMULJN-PGRXLJNUSA-N | | SMILES | [2H]c1c([2H])c2C([2H])=C([2H])c3c([2H])c([2H])c([2H])c(c1[2H])c23 | | EPA Substance Registry System | Acenaphthylene-d8 (93951-97-4) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | ACENAPHTHYLENE D8 Usage And Synthesis |
| Uses | Acenaphthylene-d8 is labelled Acenaphthylene (A130750) which is a polycyclic aromatic hydrocarbons as carcinogenic agents. |
| | ACENAPHTHYLENE D8 Preparation Products And Raw materials |
|