- Undecanoyl chloride
-
- $1.50 / 1g
-
2025-06-06
- CAS:17746-05-3
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons
- Undercanoyl chloride
-
- $15.00 / 1KG
-
2021-07-13
- CAS:17746-05-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- Undercanoyl chloride
-
- $15.00 / 1KG
-
2021-07-10
- CAS:17746-05-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Undecanoyl chloride Basic information |
| | Undecanoyl chloride Chemical Properties |
| Boiling point | 135-136 °C/20 mmHg (lit.) | | density | 0.93 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.443(lit.) | | Fp | >230 °F | | storage temp. | −20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 0.93 | | Sensitive | Moisture Sensitive | | BRN | 1759226 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3 | | InChIKey | JUKPJGZUFHCZQI-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)CCCCCCCCCC | | CAS DataBase Reference | 17746-05-3(CAS DataBase Reference) | | EPA Substance Registry System | Undecanoyl chloride (17746-05-3) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | TSCA | TSCA listed | | HS Code | 2915 90 70 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Undecanoyl chloride Usage And Synthesis |
| Uses | Undecanoyl chloride has been used in the synthesis of:
- chrysotrione B, 2-acylcyclopentene-1,3-dione derivative, isolated from the fruiting bodies of the basidiomycete Hygrophorus chrysodon
- 2-methylpentadecan-5-one
- 4-ketotetradecanoic acid
|
| | Undecanoyl chloride Preparation Products And Raw materials |
|