N,N'-Dimethyloxamide manufacturers
- N,N'-Dimethyloxalamide
-
- $1.10 / 1g
-
2025-11-18
- CAS:615-35-0
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | N,N'-Dimethyloxamide Basic information |
| | N,N'-Dimethyloxamide Chemical Properties |
| Melting point | 214-217 °C(lit.) | | density | 1.091±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Chloroform, Dichloromethane, Methanol | | pka | 11.76±0.46(Predicted) | | form | crystals | | BRN | 1753961 | | InChI | InChI=1S/C4H8N2O2/c1-5-3(7)4(8)6-2/h1-2H3,(H,5,7)(H,6,8) | | InChIKey | IPZCJUOJSODZNK-UHFFFAOYSA-N | | SMILES | C(NC)(=O)C(NC)=O | | CAS DataBase Reference | 615-35-0(CAS DataBase Reference) | | NIST Chemistry Reference | N,N'-Dimethyloxamide(615-35-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N,N'-Dimethyloxamide Usage And Synthesis |
| Uses | N,N'-Dimethyloxamide is an amide compound, mainly used in the field of organic synthesis, can be used as the preparation of imidazole drug intermediates or other heterocyclic organic compounds. |
| | N,N'-Dimethyloxamide Preparation Products And Raw materials |
|