|
|
| | Malonaldehyde bis(diethyl acetal) Basic information |
| Product Name: | Malonaldehyde bis(diethyl acetal) | | Synonyms: | 1,1,3,3-tetraethoxy-propan;Malonaldehyde diethyl acetal;Malonaldehydediethylacetal;Tetraethoxypropane;Tetraethyl malondialdehyde acetal;USAF kf-26;1,1,3,3-Tetrathoxypropane;malonaldehyde bis | | CAS: | 122-31-6 | | MF: | C11H24O4 | | MW: | 220.31 | | EINECS: | 204-533-1 | | Product Categories: | | | Mol File: | 122-31-6.mol |  |
| | Malonaldehyde bis(diethyl acetal) Chemical Properties |
| Melting point | -90 °C | | Boiling point | 220 °C (lit.) | | density | 0.919 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.411(lit.) | | Fp | 190 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Liquid | | color | Clear colorless to yellow | | Water Solubility | insoluble | | BRN | 1209619 | | InChI | InChI=1S/C11H24O4/c1-5-12-10(13-6-2)9-11(14-7-3)15-8-4/h10-11H,5-9H2,1-4H3 | | InChIKey | KVJHGPAAOUGYJX-UHFFFAOYSA-N | | SMILES | C(OCC)(OCC)CC(OCC)OCC | | CAS DataBase Reference | 122-31-6(CAS DataBase Reference) | | NIST Chemistry Reference | Propane, 1,1,3,3-tetraethoxy-(122-31-6) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36/37/39-26-24/25 | | RIDADR | 1993 | | WGK Germany | 3 | | RTECS | ON8750000 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29110000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | LD50 orally in Rabbit: 1610 mg/kg |
| | Malonaldehyde bis(diethyl acetal) Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO YELLOW LIQUID | | Uses | Organic synthesis. | | Uses | 1,1,3,3-Tetraethoxypropane has been used in the preparation of diazabicyclodecenes. |
| | Malonaldehyde bis(diethyl acetal) Preparation Products And Raw materials |
|