| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | COELENTERAZINE FCP Basic information |
| Product Name: | COELENTERAZINE FCP | | Synonyms: | CLZN-FCP;COELENTERAZINE FCP;8-(cyclopentylmethyl)-2-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-imidazo[1,2-a]pyrazin-3(7H)-one;Coelenterazine fcp solid;Imidazo[1,2-a]pyrazin-3(7H)-one, 8-(cyclopentylmethyl)-2-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)- | | CAS: | 123437-33-2 | | MF: | C25H24FN3O2 | | MW: | 417.48 | | EINECS: | | | Product Categories: | | | Mol File: | 123437-33-2.mol |  |
| | COELENTERAZINE FCP Chemical Properties |
| Boiling point | 571.5±60.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | methanol: 1mg/mL | | form | solid | | pka | 10.50±0.30(Predicted) | | InChI | 1S/C25H24FN3O2/c26-19-9-5-17(6-10-19)14-22-25(31)29-15-23(18-7-11-20(30)12-8-18)27-21(24(29)28-22)13-16-3-1-2-4-16/h5-12,15-16,27,30H,1-4,13-14H2 | | InChIKey | OLXXULUJSSTXSP-UHFFFAOYSA-N | | SMILES | Oc1ccc(cc1)C2=CN3C(=O)C(Cc4ccc(F)cc4)=NC3=C(CC5CCCC5)N2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | COELENTERAZINE FCP Usage And Synthesis |
| Biological Activity | 135 times higher luminescence intensity than native coelenterazine |
| | COELENTERAZINE FCP Preparation Products And Raw materials |
|