- TRIOCTYLSILANE
-
- $0.00 / 1KG
-
2025-07-02
- CAS:18765-09-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000KG /month
- Trioctylsilane
-
- $1.00 / 1KG
-
2020-01-09
- CAS:18765-09-8
- Min. Order: 1KG
- Purity: Min98% HPLC
- Supply Ability: g/kg/ton
|
| | TRIOCTYLSILANE Basic information |
| | TRIOCTYLSILANE Chemical Properties |
| Melting point | <0°C | | Boiling point | 163-165 °C/0.15 mmHg (lit.) | | density | 0.821 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.454(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | Specific Gravity | 0.821 | | Appearance | Light yellow to yellow Liquid | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | InChI | InChI=1S/C24H52Si/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h25H,4-24H2,1-3H3 | | InChIKey | JBAALNCKQCMFDH-UHFFFAOYSA-N | | SMILES | [SiH](CCCCCCCC)(CCCCCCCC)CCCCCCCC | | EPA Substance Registry System | Silane, trioctyl- (18765-09-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | TRIOCTYLSILANE Usage And Synthesis |
| | TRIOCTYLSILANE Preparation Products And Raw materials |
|