|
| trans-4-Methycyclohexyl isocyanate Basic information |
| trans-4-Methycyclohexyl isocyanate Chemical Properties |
Boiling point | 182°C | density | 1.04 | Fp | 60°C | storage temp. | -20°C, stored under nitrogen | solubility | Chloroform (Sparingly), Methanol (Slightly) | form | Oil | color | Colourless | InChI | InChI=1S/C8H13NO/c1-7-2-4-8(5-3-7)9-6-10/h7-8H,2-5H2,1H3/t7-,8- | InChIKey | SWSXEZOUBBVKCO-ZKCHVHJHSA-N | SMILES | [C@@H]1(N=C=O)CC[C@@H](C)CC1 | CAS DataBase Reference | 32175-00-1(CAS DataBase Reference) |
| trans-4-Methycyclohexyl isocyanate Usage And Synthesis |
Chemical Properties |
Trans-4-Methycyclohexyl isocyanate is a colorless liquid, it is stable under recommended storage conditions.
| Uses | Trans-4-Methycyclohexyl isocyanate is used in organic synthesis and experimental research. |
| trans-4-Methycyclohexyl isocyanate Preparation Products And Raw materials |
|