| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:L-Phenylalanine-13C6
CAS:56253-90-8
Package:2.5Mg,25Mg
|
|
| | L-PHENYL-D5-ALANINE Basic information |
| | L-PHENYL-D5-ALANINE Chemical Properties |
| Melting point | 270-275 °C (dec. )(lit.) | | storage temp. | Refrigerator | | solubility | Water (Slightly) | | form | Solid | | color | White to Off-White | | Appearance | white powder | | Optical Rotation | [α]25/D -33.0°, c = 1 in H2O | | InChI | 1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1D,2D,3D,4D,5D | | InChIKey | COLNVLDHVKWLRT-HRVDQBBZSA-N | | SMILES | [H]C(N)(Cc1c([2H])c([2H])c([2H])c([2H])c1[2H])C(O)=O | | CAS Number Unlabeled | 63-91-2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-PHENYL-D5-ALANINE Usage And Synthesis |
| Description | L-Phenylalanine-d5 is a stable isotope of phenylalanine can be used to study the metabolic effects and proteins expression by the analytical methods using NMR. | | Chemical Properties | White Solid | | Uses | Labeled L-Phenylalanine is an essential amino acid. L-Phenylalanine is biologically converted into L-tyrosine, another one of the DNA-encoded amino acids, which in turn is converted to L-DOPA and further converted into dopamine, norepinephrine, and epinephrine. L-Phenylalanine is produced for medical, feed, and nutritional applications such as in the preparation of Aspartame. | | Definition | ChEBI: A deuterated compound that is phenylalanine in which the five aromatic hydrogens are replaced by deuterium. | | IC 50 | NMDA Receptor |
| | L-PHENYL-D5-ALANINE Preparation Products And Raw materials |
|