| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | Acetic acid-13C2,d4 Basic information |
| | Acetic acid-13C2,d4 Chemical Properties |
| Melting point | 16.2 °C(lit.) | | Boiling point | 117-118 °C(lit.) | | density | 1.153 g/mL at 25 °C | | Fp | 40 °C | | InChI | 1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1+1D3,2+1/hD | | InChIKey | QTBSBXVTEAMEQO-KXDICUDOSA-N | | SMILES | [2H]O[13C](=O)[13C]([2H])([2H])[2H] |
| Hazard Codes | C | | Risk Statements | 10-35 | | Safety Statements | 16-26-36/37/39-45-23 | | RIDADR | UN 2789 8/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1A |
| | Acetic acid-13C2,d4 Usage And Synthesis |
| | Acetic acid-13C2,d4 Preparation Products And Raw materials |
|