|
|
| | Calcium alpha-ketovaline Basic information |
| | Calcium alpha-ketovaline Chemical Properties |
| Melting point | >330°C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C5H8O3.Ca.2H/c1-3(2)4(6)5(7)8;;;/h3H,1-2H3,(H,7,8);;; | | InChIKey | IMZGMVJQWNJKCI-UHFFFAOYSA-L | | SMILES | C(=O)(C(=O)O)C(C)C.[Ca] | | CAS DataBase Reference | 51828-94-5(CAS DataBase Reference) |
| | Calcium alpha-ketovaline Usage And Synthesis |
| Uses | 3-Methyl-2-oxobutyric Acid Calcium Salt is used in preparation of (Fluoreneylmethoxycarbonylamino)-methyl-butenoic Acid. | | Synthesis | 5-isopropyl-4,4’-dimethyldihydrofuran-2,3-dione 170.21g (1 mol) dissolved in methanol 1500g, fully stirred to dissolve, controlled temperature 0 to 55 , add calcium hydroxide 74.09g of 740.9g of propanetriol solution, stirring reaction for 8 hours, cooling 0 crystallization for 2 hours, filtration, to get ketovalentine calcium crude product 140g, molar yield 90%. Add 140g of ketovaline calcium crude product into 20% methanol aqueous solution, warm up to 55 to dissolve, cooling 0 crystallization for 2 hours, filtration, obtained ketovaline calcium crude product 123g, molar yield 87.8%. HPLC purity 99.9%.
|
| | Calcium alpha-ketovaline Preparation Products And Raw materials |
|