HEXAFLUORO-DL-VALINE manufacturers
- HEXAFLUORO-DL-VALINE
-
- $3.00 / 1KG
-
2020-02-21
- CAS:16063-80-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200KG
|
| | HEXAFLUORO-DL-VALINE Basic information |
| Product Name: | HEXAFLUORO-DL-VALINE | | Synonyms: | HEXAFLUORO-DL-VALINE;(±)-2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butyric acid;Hexafluoro-DL-valine 97%;Hexafluoro-DL-valine97%;hexafluorovaline;2-Amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid, 2-Amino-4,4,4-trifluoro-3-(trifluoromethyl)butyric acid;4,4,4,4',4',4'-Hexafluoro-DL-valine 97%;4,4,4,4',4',4'-Hexafluoro-DL-valine97% | | CAS: | 16063-80-2 | | MF: | C5H5F6NO2 | | MW: | 225.09 | | EINECS: | 240-207-5 | | Product Categories: | | | Mol File: | 16063-80-2.mol |  |
| | HEXAFLUORO-DL-VALINE Chemical Properties |
| Melting point | 204°C (dec.) | | Boiling point | 165.9±40.0 °C(Predicted) | | density | 1.575±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 1.53±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 2416649 | | Major Application | peptide synthesis | | InChI | 1S/C5H5F6NO2/c6-4(7,8)2(5(9,10)11)1(12)3(13)14/h1-2H,12H2,(H,13,14) | | InChIKey | KRNSHCKTGFAMPQ-UHFFFAOYSA-N | | SMILES | NC(C(C(F)(F)F)C(F)(F)F)C(O)=O | | CAS DataBase Reference | 16063-80-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | HEXAFLUORO-DL-VALINE Usage And Synthesis |
| | HEXAFLUORO-DL-VALINE Preparation Products And Raw materials |
| Raw materials | Valine, 4,4,4,4',4',4'-hexafluoro-, phenylmethyl ester (9CI)-->4,4,4,4',4',4'-Hexafluorovaline,ethylester |
|