- 2-Phenoxyethyl Acetate
-
- $0.00 / 10g
-
2020-02-26
- CAS: 6192-44-5
- Min. Order: 10g
- Purity: 99.0%+
- Supply Ability: 100 tons
- 2-Phenoxyethyl Acetate
-
- $0.00 / 1Kg
-
2020-02-26
- CAS: 6192-44-5
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | ACETIC ACID 2-PHENOXYETHYL ESTER Basic information |
| Product Name: | ACETIC ACID 2-PHENOXYETHYL ESTER | | Synonyms: | ETHYLENE GLYCOL MONOPHENYL ETHER ACETATE;2-PHENOXYETHYL ACETATE;ACETIC ACID 2-PHENOXYETHYL ESTER;PHENOXYETHYL ACETATE;2-phenoxy-ethanoacetate;2-phenoxyethanolacetate;2-phenoxyethylesterkyselinyoctove;aceticacidphenoxyethylester | | CAS: | 6192-44-5 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | | | Product Categories: | | | Mol File: | 6192-44-5.mol |  |
| | ACETIC ACID 2-PHENOXYETHYL ESTER Chemical Properties |
| Boiling point | 273.02°C (rough estimate) | | density | 1,11 g/cm3 | | refractive index | 1.5060-1.5100 | | Fp | 141°C | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 100.00?%. sweet floral | | InChI | InChI=1S/C10H12O3/c1-9(11)12-7-8-13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 | | InChIKey | WHFKYDMBUMLWDA-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)COC1=CC=CC=C1 | | LogP | 1.752 (est) | | EPA Substance Registry System | Ethylene glycol monophenyl ether acetate (6192-44-5) |
| RTECS | KM0525000 | | HS Code | 2915.39.3500 |
| | ACETIC ACID 2-PHENOXYETHYL ESTER Usage And Synthesis |
| Chemical Properties |
Colorless oily liquid.Practically insoluble in water, soluble in alcohol and oils.
| | Uses |
Phenoxyethyl acetate is not one of the more interesting of the series. It is rarely available commercially, and it does not offer any unique notes, or effects which cannot be obtained from other, readily available, low-cost perfume chemicals.
| | Preparation | 2-Phenoxyethyl Acetate is produced by Acetylation of Phenylcellosolve. |
| | ACETIC ACID 2-PHENOXYETHYL ESTER Preparation Products And Raw materials |
|