|
|
| | (S)-1,2,3,4-Tetrahydro-1-naphthalenamine Basic information |
| Product Name: | (S)-1,2,3,4-Tetrahydro-1-naphthalenamine | | Synonyms: | (S)-(+)-1,2,3,4-Tetrahydro-1-naphthylamine 97%;(S)-(-)-1-AMINOTETRALIN;(S)-(+)-1-AMINOTETRALIN;(S)-1-AMINOTETRALIN;(S)-(+)-1-AMINOTETRALINE;(S)-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE;(S)-(1,2,3,4-TETRAHYDRO-NAPHTHALEN-1-YL)AMINE;(S)-(+)-1,2,3,4-TETRAHYDRO-1-NAPHTHYLAMINE | | CAS: | 23357-52-0 | | MF: | C10H13N | | MW: | 147.22 | | EINECS: | 629-348-7 | | Product Categories: | Chiral;Amines;Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals;Pyrazoles | | Mol File: | 23357-52-0.mol |  |
| | (S)-1,2,3,4-Tetrahydro-1-naphthalenamine Chemical Properties |
| Boiling point | 118-120°C 7,6mm | | density | 1.010 | | refractive index | 1.565 | | Fp | >110°C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.39±0.20(Predicted) | | form | liquid | | color | colorless to pale yellow transparent | | Water Solubility | Soluble in water. | | Sensitive | Air Sensitive | | BRN | 2360279 | | InChI | InChI=1S/C10H13N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7,11H2/t10-/m0/s1 | | InChIKey | JRZGPXSSNPTNMA-JTQLQIEISA-N | | SMILES | [C@@H]1(N)C2=C(C=CC=C2)CCC1 | | CAS DataBase Reference | 23357-52-0(CAS DataBase Reference) |
| Hazard Codes | Xi,N,C | | Risk Statements | 36/37-51/53-36/37/38-34-52/53-22 | | Safety Statements | 26-36/37/39-61-45 | | RIDADR | UN 3082 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 29214500 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Skin Corr. 1C |
| Provider | Language |
|
ALFA
| English |
| | (S)-1,2,3,4-Tetrahydro-1-naphthalenamine Usage And Synthesis |
| Chemical Properties | Brown liquid | | Uses | A chiral amine derivative, (S)-1,2,3,4-Tetrahydro-1-naphthalenamine can be used in studies of real-time chiral discrimination of enantiomers as well as in studies of kinetic resolution of chiral amines with ω-transaminase using an enzyme-membrane re actor. | | Uses | (S)-(+)-1,2,3,4-Tetrahydro-1-naphthylamine is used as a chiral amine derivative used in studies of real-time chiral discrimination of enantiomers as well as in studies of kinetic resolution of chiral amines with ω-transaminase using an enzyme-membrane reactor. |
| | (S)-1,2,3,4-Tetrahydro-1-naphthalenamine Preparation Products And Raw materials |
|