|
|
| | 2,1,3-Benzothiadiazole-4-sulphonyl chloride Basic information |
| Product Name: | 2,1,3-Benzothiadiazole-4-sulphonyl chloride | | Synonyms: | 2,1,3-BENZOTHIADIAZOLE-4-SULFONYL CHLORIDE;2,1,3-BENZOTHIADIAZOLE-4-SULPHONYL CHLORIDE;ART-CHEM-BB B017627;BUTTPARK 27\04-23;BENZO-2,1,3-THIADIAZOLE-4-SULFONYL CHLORIDE;BENZO-2,1,3-THIADIAZOLE-4-SULPHONYL CHLORIDE;BENZO[1,2,5]THIADIAZOLE-4-SULFONYL CHLORIDE;TIMTEC-BB SBB007089 | | CAS: | 73713-79-8 | | MF: | C6H3ClN2O2S2 | | MW: | 234.68 | | EINECS: | | | Product Categories: | SULFONYLHALIDE;Oxadiazoles & Thiadiazoles;Sulphonyl Chlorides;Benzenesulfonyl chloride;Oxadiazoles & Thiadiazoles;Sulphonyl Chlorides | | Mol File: | 73713-79-8.mol |  |
| | 2,1,3-Benzothiadiazole-4-sulphonyl chloride Chemical Properties |
| Melting point | 148 °C | | Boiling point | 359.4±15.0 °C(Predicted) | | density | 1.723±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.69±0.45(Predicted) | | InChI | InChI=1S/C6H3ClN2O2S2/c7-13(10,11)5-3-1-2-4-6(5)9-12-8-4/h1-3H | | InChIKey | CXAICGCTHOWKPP-UHFFFAOYSA-N | | SMILES | N1=C2C=CC=C(S(Cl)(=O)=O)C2=NS1 | | CAS DataBase Reference | 73713-79-8(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36 | | Safety Statements | 26-36/37/39 | | RIDADR | 3261 | | RTECS | DL0100000 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2934999090 |
| Provider | Language |
|
ALFA
| English |
| | 2,1,3-Benzothiadiazole-4-sulphonyl chloride Usage And Synthesis |
| | 2,1,3-Benzothiadiazole-4-sulphonyl chloride Preparation Products And Raw materials |
|