|
|
| | 3-(Trifluoromethyl)benzenesulfonamide Basic information |
| | 3-(Trifluoromethyl)benzenesulfonamide Chemical Properties |
| Melting point | 122-126 °C(lit.) | | Boiling point | 314.3±52.0 °C(Predicted) | | density | 1.482±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 9.69±0.60(Predicted) | | color | White to Almost white | | BRN | 2696480 | | InChI | 1S/C7H6F3NO2S/c8-7(9,10)5-2-1-3-6(4-5)14(11,12)13/h1-4H,(H2,11,12,13) | | InChIKey | ZUTVRDMZQSHCID-UHFFFAOYSA-N | | SMILES | NS(=O)(=O)c1cccc(c1)C(F)(F)F | | CAS DataBase Reference | 672-58-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | PackingGroup | I | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids |
| | 3-(Trifluoromethyl)benzenesulfonamide Usage And Synthesis |
| | 3-(Trifluoromethyl)benzenesulfonamide Preparation Products And Raw materials |
|