- L-amino compound
-
-
2026-08-22
- CAS:716-61-0
- Min. Order: 25kg
- Purity: 99%
- Supply Ability: 2000
|
| | D-(-)-THREO-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL Basic information |
| Product Name: | D-(-)-THREO-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL | | Synonyms: | ChloromycinbaseL-base;D-(-)-THREO-2-AMINO-1-(4-NITRO;(1R,2R)-1-(4-Nitrophenyl)-2-aminopropane-1,3-diol;[1R,2R,(-)]-2-Amino-1-(p-nitrophenyl)-1,3-propanediol;(1R,2R)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol,96%;(1R,2R)-()-2-Amino-1-(4-nitrophenyl)-1,3-propanediol,D-()-threo-2-Amino-1-(p-nitrophenyl)-1,3-propanediol, Chloramphenicol base;(1R,2R)-2-AMino-1-(4-nitrophenyl)propane-1,3-diol, 96% 5GR;(1R,2R)-(-)-2-AMino-1-(4-nitrophenyl)-1,3-propanediol 99% | | CAS: | 716-61-0 | | MF: | C9H12N2O4 | | MW: | 212.2 | | EINECS: | 211-938-7 | | Product Categories: | Amino Alcohols (Chiral);Chiral Building Blocks;for Resolution of Acids;Antibiotics;Cell Culture;Reagents and Supplements;Optical Resolution;Synthetic Organic Chemistry;716-61-0 | | Mol File: | 716-61-0.mol |  |
| | D-(-)-THREO-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL Chemical Properties |
| Melting point | 163-165 °C(lit.) | | Boiling point | 352.03°C (rough estimate) | | density | 1.3136 (rough estimate) | | refractive index | -30.5 ° (C=1, 6mol/L HCl) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | almost transparency in hot Water | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Powder | | pka | 10.98±0.45(Predicted) | | color | Light yellow | | Optical Rotation | [α]25/D 30°, c = 1 in 6 M HCl | | InChI | InChI=1S/C9H12N2O4/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15/h1-4,8-9,12-13H,5,10H2/t8-,9-/m1/s1 | | InChIKey | OCYJXSUPZMNXEN-RKDXNWHRSA-N | | SMILES | [C@H](C1=CC=C([N+]([O-])=O)C=C1)(O)[C@H](N)CO |
| Hazard Codes | Xn,T | | Risk Statements | 22-36/37/38-45 | | Safety Statements | 26-45-53-22 | | RIDADR | UN 3259 8/PG 3 | | WGK Germany | 3 | | RTECS | TY3100000 | | HazardClass | 8 | | HS Code | 29221990 |
| | D-(-)-THREO-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL Usage And Synthesis |
| Chemical Properties | light yellow powder | | Uses | D-threo-(-)-2-Amino-1-(4-nitrophenyl)-1,3-propanediol is an impurity of Chloramphenicol (C325030), a broad spectrum antibiotic agent obtained from cultures of the soil bacterium Streptomyces venezuel
ae. | | Uses | Chloramphenicol base is the parent 4-nitrophenylpropylamine formed by the hydrolysis of the dichloroacetamide of chloramphenicol and is a degradation product commonly encountered with commercial production of chloramphenicol. Chloramphenicol base has no antibiotic activity but has played an integral role in the synthesis and SAR of new generation antibiotics, notably thiamphenicol and experimental analogues, bromamphenicol and methamphenicol. | | Uses | (1R,2R)-(-)-2-Amino-1-(4-nitrophenyl)-1,3-propanediol may be used in the preparation of (1R,2R)-(-)-2-dimethylamino-1-(4-nitrophenyl)-1,3-propanediol via N,N-dimethylation. It may also be used as a starting material to synthesize (1R,2R)-1,3-diacetoxy-1-(4-nitrophenyl)-2-propylisothioeyanate [(R,R)-DANI]. | | Definition | ChEBI: A diol that is propane 1,3-diol bearing additional amino and 4-nitrophenyl substituents at positions 2 and 1 respectively. |
| | D-(-)-THREO-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL Preparation Products And Raw materials |
|