|
|
| | 2,3-Dimethoxybenzoic acid Basic information |
| Product Name: | 2,3-Dimethoxybenzoic acid | | Synonyms: | RARECHEM AL BO 0026;O-VERATRIC ACID;2,3-dimethoxy-benzoicaci;Benzoic acid, 2,3-dimethoxy-;2,3-DIMETHOXYBENZOIC ACID;2-VERATRIC ACID;AKOS 233-29;DIMETHOXYBENZOIC ACID,2,3- | | CAS: | 1521-38-6 | | MF: | C9H10O4 | | MW: | 182.17 | | EINECS: | 216-188-4 | | Product Categories: | C9;Carbonyl Compounds;Carboxylic Acids;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;BUILDING BLOCKS;BenzoicAcidDerivative;Benzoic acid;Organic acids;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks | | Mol File: | 1521-38-6.mol |  |
| | 2,3-Dimethoxybenzoic acid Chemical Properties |
| Melting point | 120-122 °C (lit.) | | Boiling point | 275.56°C (rough estimate) | | density | 1.2481 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | 5.310g/l slightly soluble | | pka | 3.97±0.10(Predicted) | | form | Fine Crystalline Powder | | color | Light beige | | Water Solubility | slightly soluble | | BRN | 2210858 | | InChI | InChI=1S/C9H10O4/c1-12-7-5-3-4-6(9(10)11)8(7)13-2/h3-5H,1-2H3,(H,10,11) | | InChIKey | FODBVCSYJKNBLO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(OC)=C1OC | | LogP | 0.907 (est) | | CAS DataBase Reference | 1521-38-6(CAS DataBase Reference) | | NIST Chemistry Reference | 2,3-Dimethoxybenzoic acid(1521-38-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | RTECS | DG8598700 | | Hazard Note | Irritant | | HS Code | 29189090 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intraperitoneal,> 800mg/kg (800mg/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 196, Pg. 478, 1976. |
| | 2,3-Dimethoxybenzoic acid Usage And Synthesis |
| Chemical Properties | LIGHT BEIGE FINE CRYSTALLINE POWDER | | Uses | 2,3-Dimethoxybenzoic acid is widely used as an intermediate in organic synthesis, its methoxy-substituted aromatic ring enables selective functionalization, making it useful in the preparation of more complex aromatic and heterocyclic derivatives. In addition, it is applied in material science research for the development of functionalized polymers and organic electronic materials, where its structural and electronic properties can influence conductivity, stability, and overall material performance. | | Synthesis | The general procedure for the synthesis of 2,3-dimethoxybenzoic acid from o-anisidine and carbon dioxide is as follows: an o-o-metalation reaction was carried out according to the method described in Example 1, using different substrates and CO2 as an electrophilic reagent. | | References | [1] Angewandte Chemie - International Edition, 2002, vol. 41, # 2, p. 340 - 343
[2] Patent: US6384273, 2002, B1. Location in patent: Page column 9 |
| | 2,3-Dimethoxybenzoic acid Preparation Products And Raw materials |
| Raw materials | 1,2-Dimethoxybenzene-->Carbon dioxide-->Sodium-->Toluene | | Preparation Products | methyl 2-(7-hydroxybenzofuran-3-yl)acetate-->2,3-DIMETHOXYANILINE-->6-Formyl-2,3-dimethoxybenzoic acid-->7-METHOXY-3(2H)-BENZOFURANONE-->1,3-BENZODIOXOLE-4-CARBOXYLIC ACID-->2,3,3',4'-TETRAMETHOXYBENZOPHENONE-->Hydrazine, (2,3-dimethoxyphenyl)--->2,3-DIMETHOXY-BENZOYL CHLORIDE |
|