|
|
| | 3,4-Dihydroxyacetophenone Basic information |
| | 3,4-Dihydroxyacetophenone Chemical Properties |
| Melting point | 117 °C | | Boiling point | 127-133 °C(Press: 11 Torr) | | density | 1.291±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Soluble), Methanol (Slightly) | | pka | 8.00±0.18(Predicted) | | form | Solid | | color | Off-White to Beige | | InChI | InChI=1S/C8H8O3/c1-5(9)6-2-3-7(10)8(11)4-6/h2-4,10-11H,1H3 | | InChIKey | UCQUAMAQHHEXGD-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C(O)=C1)C | | LogP | 1.056 (est) | | CAS DataBase Reference | 1197-09-7(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4-Dihydroxyacetophenone(1197-09-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-36/37 | | RTECS | KM5775200 | | HazardClass | IRRITANT | | HS Code | 2914390090 |
| | 3,4-Dihydroxyacetophenone Usage And Synthesis |
| Uses | 3'',4''-Dihydroxyacetophenone is an active constituent of Chinese medicine and also has antimelanogenic actiivity. | | Definition | ChEBI: 3,4-dihydroxyacetophenone is a member of acetophenones. It has a role as a metabolite. | | Preparation | Preparation by Fries rearrangement of pyrocatechol diacetate with aluminium chloride in nitrobenzene between 75° and 95° (80%)(43%)or in chlorobenzene at 80° (83%). |
| | 3,4-Dihydroxyacetophenone Preparation Products And Raw materials |
|