|
|
| | 3-BROMO-N,N-DIMETHYLANILINE Basic information |
| | 3-BROMO-N,N-DIMETHYLANILINE Chemical Properties |
| Melting point | 11°C | | Boiling point | 126°C 14mm | | density | 1.402 g/mL at 25 °C | | refractive index | 1.6004 | | Fp | 126°C/14mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Miscible with chloroform, dichloromethane and methanol. | | pka | 3.90±0.10(Predicted) | | form | liquid | | color | Yellow | | BRN | 2079908 | | InChI | InChI=1S/C8H10BrN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 | | InChIKey | USEXQPWLCGBYNT-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=CC(Br)=C1 | | CAS DataBase Reference | 16518-62-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-33 | | Safety Statements | 26-36/37/39 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2921420090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Irrit. 2 STOT RE 2 |
| Provider | Language |
|
ALFA
| English |
| | 3-BROMO-N,N-DIMETHYLANILINE Usage And Synthesis |
| Chemical Properties | Light Yellow Liquid | | Uses | 3-Bromo-N,N-dimethylaniline is involved in fluorination using metal fluoride in the presence of 2-(di-1-adamantylphosphino)-3,6-dimethoxy-2',4',6'-tri-i-propyl-1,1'-biphenyl (AdBrettPhos)-based Pd precatalyst, used to prepare 3-fluoro-N,N- dimethylaniline. |
| | 3-BROMO-N,N-DIMETHYLANILINE Preparation Products And Raw materials |
|