|
|
| | Labetalone hydrochloride Basic information |
| Product Name: | Labetalone hydrochloride | | Synonyms: | Labetalol EP Impurity F HCl;2-hydroxy-5-[2-(4-phenylbutan-2-ylamino)acetyl]benzamide;BENZOYLAMIDE;BENZOIC AMIDE;benzenecarbonamide;LABETALONE HYDROCHLORIDE 98.0+%;Labetalone hydrochloride;2-Hydroxy-5-(2-(4-phenylbutan-2-ylamino)acetyl)benzamide hydrochloride | | CAS: | 96441-14-4 | | MF: | C19H22N2O3.ClH | | MW: | 362.86 | | EINECS: | 700-288-4 | | Product Categories: | | | Mol File: | 96441-14-4.mol |  |
| | Labetalone hydrochloride Chemical Properties |
| Melting point | 125-128 °C(lit.) | | Boiling point | 523.92℃[at 101 325 Pa] | | storage temp. | Store at -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | 28.61mg/L at 25℃ | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C19H22N2O3.ClH/c1-13(7-8-14-5-3-2-4-6-14)21-12-18(23)15-9-10-17(22)16(11-15)19(20)24;/h2-6,9-11,13,21-22H,7-8,12H2,1H3,(H2,20,24);1H | | InChIKey | DJHFVUYXWAEVRA-UHFFFAOYSA-N | | SMILES | Cl.N(C(CCc2ccccc2)C)CC(=O)c1cc(c(cc1)O)C(=O)N | | LogP | 3.58 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | WGK Germany | 1 | | RTECS | CU8700000 | | Storage Class | 11 - Combustible Solids |
| | Labetalone hydrochloride Usage And Synthesis |
| Description | Labetalone hydrochloride is hydrochloride form of labetalone. Labetalol is an orally active adrenoceptor blocking drug which is a competitive antagonist at both alpha- and beta-adrenoceptor sites. Labetalone hydrochloride is used as an antihypertensive. | | Uses | rac-Keto Labetalol Hydrochloride is an impurity of Labetalol (L096495), a specific competitive antagonist at both a-and b-adrenergic receptor sites. Labetalol is used as an antihypertensive. |
| | Labetalone hydrochloride Preparation Products And Raw materials |
|